C19H17N3 — CID 7539
1,2,3-triphenylguanidine (PubChem CID 7539) has the molecular formula C19H17N3 and a molecular weight of 287.37 g/mol. Its IUPAC name is 1,2,3-triphenylguanidine.
| Compound Name | 1,2,3-triphenylguanidine |
|---|---|
| PubChem CID | 7539 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1,2,3-triphenylguanidine |
| SMILES | c1ccc(N=C(Nc2ccccc2)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H17N3/c1-4-10-16(11-5-1)20-19(21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H,(H2,20,21,22) |
| InChIKey | FUPAJKKAHDLPAZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|