About 1,2,3-triphenylguanidine
1,2,3-triphenylguanidine (PubChem CID 7539) has the molecular formula C19H17N3
and a molecular weight of 287.37 g/mol. Its IUPAC name is 1,2,3-triphenylguanidine.
Molecular Properties
| Compound Name | 1,2,3-triphenylguanidine |
| PubChem CID | 7539 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1,2,3-triphenylguanidine |
| SMILES | c1ccc(N=C(Nc2ccccc2)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H17N3/c1-4-10-16(11-5-1)20-19(21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H,(H2,20,21,22) |
| InChIKey | FUPAJKKAHDLPAZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-triphenylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-triphenylguanidine?
The IUPAC name of 1,2,3-triphenylguanidine (CID 7539) is 1,2,3-triphenylguanidine.
What is the SMILES notation for 1,2,3-triphenylguanidine?
The canonical SMILES for 1,2,3-triphenylguanidine is c1ccc(N=C(Nc2ccccc2)Nc2ccccc2)cc1.
What is the InChIKey of 1,2,3-triphenylguanidine?
The InChIKey is FUPAJKKAHDLPAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3/c1-4-10-16(11-5-1)20-19(21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H,(H2,20,21,22).
What are the key properties of 1,2,3-triphenylguanidine?
1,2,3-triphenylguanidine has a molecular weight of 287.37 g/mol, XLogP of 4.90, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-triphenylguanidine is sourced from PubChem (CID 7539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).