About 1,2-diphenylguanidine
1,2-diphenylguanidine (PubChem CID 7594) has the molecular formula C13H13N3
and a molecular weight of 211.27 g/mol. Its IUPAC name is 1,2-diphenylguanidine.
Molecular Properties
| Compound Name | 1,2-diphenylguanidine |
| PubChem CID | 7594 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1,2-diphenylguanidine |
| SMILES | N/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C13H13N3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H,(H3,14,15,16) |
| InChIKey | OWRCNXZUPFZXOS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diphenylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylguanidine?
The IUPAC name of 1,2-diphenylguanidine (CID 7594) is 1,2-diphenylguanidine.
What is the SMILES notation for 1,2-diphenylguanidine?
The canonical SMILES for 1,2-diphenylguanidine is N/C(=N\c1ccccc1)Nc1ccccc1.
What is the InChIKey of 1,2-diphenylguanidine?
The InChIKey is OWRCNXZUPFZXOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H,(H3,14,15,16).
What are the key properties of 1,2-diphenylguanidine?
1,2-diphenylguanidine has a molecular weight of 211.27 g/mol, XLogP of 2.74, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylguanidine is sourced from PubChem (CID 7594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).