C14H14N2 — CID 12117
N,N'-diphenylethanimidamide (PubChem CID 12117) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N,N'-diphenylethanimidamide.
| Compound Name | N,N'-diphenylethanimidamide |
|---|---|
| PubChem CID | 12117 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N,N'-diphenylethanimidamide |
| SMILES | C/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C14H14N2/c1-12(15-13-8-4-2-5-9-13)16-14-10-6-3-7-11-14/h2-11H,1H3,(H,15,16) |
| InChIKey | CLWIJUQLAFJNOF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|