About 1-cyano-N,N'-diphenylmethanimidamide
1-cyano-N,N'-diphenylmethanimidamide (PubChem CID 22814) has the molecular formula C14H11N3
and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-cyano-N,N'-diphenylmethanimidamide.
Molecular Properties
| Compound Name | 1-cyano-N,N'-diphenylmethanimidamide |
| PubChem CID | 22814 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-cyano-N,N'-diphenylmethanimidamide |
| SMILES | N#C/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C14H11N3/c15-11-14(16-12-7-3-1-4-8-12)17-13-9-5-2-6-10-13/h1-10H,(H,16,17) |
| InChIKey | CPFBIBCZHAOUDH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-N,N'-diphenylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N,N'-diphenylmethanimidamide?
The IUPAC name of 1-cyano-N,N'-diphenylmethanimidamide (CID 22814) is 1-cyano-N,N'-diphenylmethanimidamide.
What is the SMILES notation for 1-cyano-N,N'-diphenylmethanimidamide?
The canonical SMILES for 1-cyano-N,N'-diphenylmethanimidamide is N#C/C(=N\c1ccccc1)Nc1ccccc1.
What is the InChIKey of 1-cyano-N,N'-diphenylmethanimidamide?
The InChIKey is CPFBIBCZHAOUDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3/c15-11-14(16-12-7-3-1-4-8-12)17-13-9-5-2-6-10-13/h1-10H,(H,16,17).
What are the key properties of 1-cyano-N,N'-diphenylmethanimidamide?
1-cyano-N,N'-diphenylmethanimidamide has a molecular weight of 221.26 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N,N'-diphenylmethanimidamide is sourced from PubChem (CID 22814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).