C15H12ClN5 — CID 16088
6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine (PubChem CID 16088) has the molecular formula C15H12ClN5 and a molecular weight of 297.75 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 16088 |
| Molecular Formula | C15H12ClN5 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Clc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H12ClN5/c16-13-19-14(17-11-7-3-1-4-8-11)21-15(20-13)18-12-9-5-2-6-10-12/h1-10H,(H2,17,18,19,20,21) |
| InChIKey | AHBSUJXKRKWNBN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |