About Melarsen oxide
Melarsen oxide (PubChem CID 30830) has the molecular formula C9H9AsN6O
and a molecular weight of 292.13 g/mol. Its IUPAC name is 2-N-(4-arsorosophenyl)-1,3,5-triazine-2,4,6-triamine.
Molecular Properties
| Compound Name | Melarsen oxide |
| PubChem CID | 30830 |
| Molecular Formula | C9H9AsN6O |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-N-(4-arsorosophenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC(=N2)N)N)[As]=O |
| InChI | InChI=1S/C9H9AsN6O/c11-7-14-8(12)16-9(15-7)13-6-3-1-5(10-17)2-4-6/h1-4H,(H5,11,12,13,14,15,16) |
| InChIKey | YDKGKLBKFOIXPU-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 120.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 250 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Melarsen oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Melarsen oxide?
The IUPAC name of Melarsen oxide (CID 30830) is 2-N-(4-arsorosophenyl)-1,3,5-triazine-2,4,6-triamine.
What is the SMILES notation for Melarsen oxide?
The canonical SMILES for Melarsen oxide is C1=CC(=CC=C1NC2=NC(=NC(=N2)N)N)[As]=O.
What is the InChIKey of Melarsen oxide?
The InChIKey is YDKGKLBKFOIXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9AsN6O/c11-7-14-8(12)16-9(15-7)13-6-3-1-5(10-17)2-4-6/h1-4H,(H5,11,12,13,14,15,16).
What are the key properties of Melarsen oxide?
Melarsen oxide has a molecular weight of 292.13 g/mol, XLogP of not available, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Melarsen oxide is sourced from PubChem (CID 30830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).