C9H9N5 — CID 10832
2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 10832) has the molecular formula C9H9N5 and a molecular weight of 187.21 g/mol. Its IUPAC name is 2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10832 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ncnc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C9H9N5/c10-8-11-6-12-9(14-8)13-7-4-2-1-3-5-7/h1-6H,(H3,10,11,12,13,14) |
| InChIKey | YMFGJWGABDOFID-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |