C10H10ClN5 — CID 840843
6-chloro-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 840843) has the molecular formula C10H10ClN5 and a molecular weight of 235.68 g/mol. Its IUPAC name is 6-chloro-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 840843 |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.68 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 6-chloro-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Cl)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C10H10ClN5/c1-12-9-14-8(11)15-10(16-9)13-7-5-3-2-4-6-7/h2-6H,1H3,(H2,12,13,14,15,16) |
| InChIKey | KUEPSUSMVBMYAG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |