C9H5Cl3N4 — CID 7541
4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine (PubChem CID 7541) has the molecular formula C9H5Cl3N4 and a molecular weight of 275.53 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 7541 |
| Molecular Formula | C9H5Cl3N4 |
| Molecular Weight | 275.53 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(Nc2ccccc2Cl)n1 |
| InChI | InChI=1S/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16) |
| InChIKey | IMHBYKMAHXWHRP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |