C12H12ClN5 — CID 3107858
6-chloro-2-N-phenyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 3107858) has the molecular formula C12H12ClN5 and a molecular weight of 261.72 g/mol. Its IUPAC name is 6-chloro-2-N-phenyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-phenyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3107858 |
| Molecular Formula | C12H12ClN5 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 6-chloro-2-N-phenyl-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(Cl)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H12ClN5/c1-2-8-14-11-16-10(13)17-12(18-11)15-9-6-4-3-5-7-9/h2-7H,1,8H2,(H2,14,15,16,17,18) |
| InChIKey | RHMPTNSOZLNNAR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|