C15H13N3O4S — CID 82563075
2-(3-methylsulfonylanilino)-3H-benzimidazole-5-carboxylic acid (PubChem CID 82563075) has the molecular formula C15H13N3O4S and a molecular weight of 331.35 g/mol. Its IUPAC name is 2-(3-methylsulfonylanilino)-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-(3-methylsulfonylanilino)-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82563075 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-(3-methylsulfonylanilino)-3H-benzimidazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)c1cccc(Nc2nc3ccc(C(=O)O)cc3[nH]2)c1 |
| InChI | InChI=1S/C15H13N3O4S/c1-23(21,22)11-4-2-3-10(8-11)16-15-17-12-6-5-9(14(19)20)7-13(12)18-15/h2-8H,1H3,(H,19,20)(H2,16,17,18) |
| InChIKey | KXMVCEDWSJEMLD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |