2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid

C11H8N4O2S — CID 87456745

IUPAC2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid
SMILESO=C(O)c1ccc2nc(Nc3nccs3)[nH]c2c1
InChIInChI=1S/C11H8N4O2S/c16-9(17)6-1-2-7-8(5-6)14-10(13-7)15-11-12-3-4-18-11/h1-5H,(H,16,17)(H2,12,13,14,15)
InChIKeyAUKRPPFEESUNMN-UHFFFAOYSA-N
MW260.28 g/mol
LogP2.46
Rot. Bonds3

About 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid

2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid (PubChem CID 87456745) has the molecular formula C11H8N4O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid
PubChem CID87456745
Molecular FormulaC11H8N4O2S
Molecular Weight260.28 g/mol
Exact Mass260.04
IUPAC Name2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid
SMILESO=C(O)c1ccc2nc(Nc3nccs3)[nH]c2c1
InChIInChI=1S/C11H8N4O2S/c16-9(17)6-1-2-7-8(5-6)14-10(13-7)15-11-12-3-4-18-11/h1-5H,(H,16,17)(H2,12,13,14,15)
InChIKeyAUKRPPFEESUNMN-UHFFFAOYSA-N
XLogP2.46
TPSA90.90 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.28
LogP ≤ 52.46
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid?
The IUPAC name of 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid (CID 87456745) is 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid.
What is the SMILES notation for 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid?
The canonical SMILES for 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid is O=C(O)c1ccc2nc(Nc3nccs3)[nH]c2c1.
What is the InChIKey of 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid?
The InChIKey is AUKRPPFEESUNMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O2S/c16-9(17)6-1-2-7-8(5-6)14-10(13-7)15-11-12-3-4-18-11/h1-5H,(H,16,17)(H2,12,13,14,15).
What are the key properties of 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid?
2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid has a molecular weight of 260.28 g/mol, XLogP of 2.46, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-ylamino)-3H-benzimidazole-5-carboxylic acid is sourced from PubChem (CID 87456745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).