C18H14N4O2S — CID 82563265
methyl 4-[[6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-yl]amino]benzoate (PubChem CID 82563265) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is methyl 4-[[6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 82563265 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | methyl 4-[[6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc3ccc(-c4nccs4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C18H14N4O2S/c1-24-17(23)11-2-5-13(6-3-11)20-18-21-14-7-4-12(10-15(14)22-18)16-19-8-9-25-16/h2-10H,1H3,(H2,20,21,22) |
| InChIKey | YYSBIWPKPGXMEG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |