C26H34N4O3 — CID 71160709
methyl 4-[[6-[bis(3-methylbutyl)carbamoyl]-1H-benzimidazol-2-yl]amino]benzoate (PubChem CID 71160709) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is methyl 4-[[6-[bis(3-methylbutyl)carbamoyl]-1H-benzimidazol-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-[bis(3-methylbutyl)carbamoyl]-1H-benzimidazol-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 71160709 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | methyl 4-[[6-[bis(3-methylbutyl)carbamoyl]-1H-benzimidazol-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc3ccc(C(=O)N(CCC(C)C)CCC(C)C)cc3[nH]2)cc1 |
| InChI | InChI=1S/C26H34N4O3/c1-17(2)12-14-30(15-13-18(3)4)24(31)20-8-11-22-23(16-20)29-26(28-22)27-21-9-6-19(7-10-21)25(32)33-5/h6-11,16-18H,12-15H2,1-5H3,(H2,27,28,29) |
| InChIKey | KGMRIGBFCKIQPE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |