C16H11FN4S — CID 82563238
N-(4-fluorophenyl)-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine (PubChem CID 82563238) has the molecular formula C16H11FN4S and a molecular weight of 310.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine.
| Compound Name | N-(4-fluorophenyl)-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 82563238 |
| Molecular Formula | C16H11FN4S |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-(4-fluorophenyl)-6-(1,3-thiazol-2-yl)-1H-benzimidazol-2-amine |
| SMILES | Fc1ccc(Nc2nc3ccc(-c4nccs4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C16H11FN4S/c17-11-2-4-12(5-3-11)19-16-20-13-6-1-10(9-14(13)21-16)15-18-7-8-22-15/h1-9H,(H2,19,20,21) |
| InChIKey | HKWOVPXRYZXZHR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |