C28H24N6O2 — CID 14666426
6-[2-(4-methoxyanilino)-3H-benzimidazol-5-yl]-N-(4-methoxyphenyl)-1H-benzimidazol-2-amine (PubChem CID 14666426) has the molecular formula C28H24N6O2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 6-[2-(4-methoxyanilino)-3H-benzimidazol-5-yl]-N-(4-methoxyphenyl)-1H-benzimidazol-2-amine.
| Compound Name | 6-[2-(4-methoxyanilino)-3H-benzimidazol-5-yl]-N-(4-methoxyphenyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 14666426 |
| Molecular Formula | C28H24N6O2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 6-[2-(4-methoxyanilino)-3H-benzimidazol-5-yl]-N-(4-methoxyphenyl)-1H-benzimidazol-2-amine |
| SMILES | COc1ccc(Nc2nc3ccc(-c4ccc5nc(Nc6ccc(OC)cc6)[nH]c5c4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C28H24N6O2/c1-35-21-9-5-19(6-10-21)29-27-31-23-13-3-17(15-25(23)33-27)18-4-14-24-26(16-18)34-28(32-24)30-20-7-11-22(36-2)12-8-20/h3-16H,1-2H3,(H2,29,31,33)(H2,30,32,34) |
| InChIKey | TZWFHMXRLAPIIR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |