C15H15N3O3S — CID 82562597
6-methoxy-N-(3-methylsulfonylphenyl)-1H-benzimidazol-2-amine (PubChem CID 82562597) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 6-methoxy-N-(3-methylsulfonylphenyl)-1H-benzimidazol-2-amine.
| Compound Name | 6-methoxy-N-(3-methylsulfonylphenyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 82562597 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 6-methoxy-N-(3-methylsulfonylphenyl)-1H-benzimidazol-2-amine |
| SMILES | COc1ccc2nc(Nc3cccc(S(C)(=O)=O)c3)[nH]c2c1 |
| InChI | InChI=1S/C15H15N3O3S/c1-21-11-6-7-13-14(9-11)18-15(17-13)16-10-4-3-5-12(8-10)22(2,19)20/h3-9H,1-2H3,(H2,16,17,18) |
| InChIKey | XQYWFOOZNIMWSO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |