C15H12F3N3O — CID 82562585
6-methoxy-N-[2-(trifluoromethyl)phenyl]-1H-benzimidazol-2-amine (PubChem CID 82562585) has the molecular formula C15H12F3N3O and a molecular weight of 307.28 g/mol. Its IUPAC name is 6-methoxy-N-[2-(trifluoromethyl)phenyl]-1H-benzimidazol-2-amine.
| Compound Name | 6-methoxy-N-[2-(trifluoromethyl)phenyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 82562585 |
| Molecular Formula | C15H12F3N3O |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 6-methoxy-N-[2-(trifluoromethyl)phenyl]-1H-benzimidazol-2-amine |
| SMILES | COc1ccc2nc(Nc3ccccc3C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C15H12F3N3O/c1-22-9-6-7-12-13(8-9)21-14(20-12)19-11-5-3-2-4-10(11)15(16,17)18/h2-8H,1H3,(H2,19,20,21) |
| InChIKey | FQCUGLZXHNFRNL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |