C12H8N2S2 — CID 901538
2-[4-(1,3-thiazol-2-yl)phenyl]-1,3-thiazole (PubChem CID 901538) has the molecular formula C12H8N2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-[4-(1,3-thiazol-2-yl)phenyl]-1,3-thiazole.
| Compound Name | 2-[4-(1,3-thiazol-2-yl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 901538 |
| Molecular Formula | C12H8N2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 2-[4-(1,3-thiazol-2-yl)phenyl]-1,3-thiazole |
| SMILES | c1csc(-c2ccc(-c3nccs3)cc2)n1 |
| InChI | InChI=1S/C12H8N2S2/c1-2-10(12-14-6-8-16-12)4-3-9(1)11-13-5-7-15-11/h1-8H |
| InChIKey | OVJDELRUCUZAHH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |