C12H10FNS — CID 91119367
2-[4-(1-fluoroprop-2-enyl)phenyl]-1,3-thiazole (PubChem CID 91119367) has the molecular formula C12H10FNS and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[4-(1-fluoroprop-2-enyl)phenyl]-1,3-thiazole.
| Compound Name | 2-[4-(1-fluoroprop-2-enyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 91119367 |
| Molecular Formula | C12H10FNS |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-[4-(1-fluoroprop-2-enyl)phenyl]-1,3-thiazole |
| SMILES | C=CC(F)c1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C12H10FNS/c1-2-11(13)9-3-5-10(6-4-9)12-14-7-8-15-12/h2-8,11H,1H2 |
| InChIKey | HGZOLRVSNMAKPW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|