C19H12N2OS2 — CID 146425122
bis[4-(1,3-thiazol-2-yl)phenyl]methanone (PubChem CID 146425122) has the molecular formula C19H12N2OS2 and a molecular weight of 348.45 g/mol. Its IUPAC name is bis[4-(1,3-thiazol-2-yl)phenyl]methanone.
| Compound Name | bis[4-(1,3-thiazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 146425122 |
| Molecular Formula | C19H12N2OS2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | bis[4-(1,3-thiazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2nccs2)cc1)c1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C19H12N2OS2/c22-17(13-1-5-15(6-2-13)18-20-9-11-23-18)14-3-7-16(8-4-14)19-21-10-12-24-19/h1-12H |
| InChIKey | YXLOCNQJEZDDJR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |