C12H11NS — CID 141281428
2-(3-prop-2-enylphenyl)-1,3-thiazole (PubChem CID 141281428) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-(3-prop-2-enylphenyl)-1,3-thiazole.
| Compound Name | 2-(3-prop-2-enylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 141281428 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-(3-prop-2-enylphenyl)-1,3-thiazole |
| SMILES | C=CCc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C12H11NS/c1-2-4-10-5-3-6-11(9-10)12-13-7-8-14-12/h2-3,5-9H,1,4H2 |
| InChIKey | QVAXTLLLCWPWIT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|