C9H6ClNS — CID 23135786
2-(3-chlorophenyl)-1,3-thiazole (PubChem CID 23135786) has the molecular formula C9H6ClNS and a molecular weight of 195.67 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1,3-thiazole.
| Compound Name | 2-(3-chlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 23135786 |
| Molecular Formula | C9H6ClNS |
| Molecular Weight | 195.67 g/mol |
| Exact Mass | 194.99 |
| IUPAC Name | 2-(3-chlorophenyl)-1,3-thiazole |
| SMILES | Clc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C9H6ClNS/c10-8-3-1-2-7(6-8)9-11-4-5-12-9/h1-6H |
| InChIKey | VXHUOXFRQZBAMY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.67 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |