C17H15ClN2S — CID 60928680
N-[1-(3-chlorophenyl)ethyl]-4-(1,3-thiazol-2-yl)aniline (PubChem CID 60928680) has the molecular formula C17H15ClN2S and a molecular weight of 314.84 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-4-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-4-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 60928680 |
| Molecular Formula | C17H15ClN2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-4-(1,3-thiazol-2-yl)aniline |
| SMILES | CC(Nc1ccc(-c2nccs2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15ClN2S/c1-12(14-3-2-4-15(18)11-14)20-16-7-5-13(6-8-16)17-19-9-10-21-17/h2-12,20H,1H3 |
| InChIKey | RQRXXJBUAHYZGJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |