C12H13NS — CID 22945701
2-(3-propan-2-ylphenyl)-1,3-thiazole (PubChem CID 22945701) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is 2-(3-propan-2-ylphenyl)-1,3-thiazole.
| Compound Name | 2-(3-propan-2-ylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 22945701 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-(3-propan-2-ylphenyl)-1,3-thiazole |
| SMILES | CC(C)c1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C12H13NS/c1-9(2)10-4-3-5-11(8-10)12-13-6-7-14-12/h3-9H,1-2H3 |
| InChIKey | PHPCPCHQEQHELD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |