C12H14N2S — CID 173380030
N,N-dimethyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine (PubChem CID 173380030) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine.
| Compound Name | N,N-dimethyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 173380030 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | N,N-dimethyl-1-[3-(1,3-thiazol-2-yl)phenyl]methanamine |
| SMILES | CN(C)Cc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C12H14N2S/c1-14(2)9-10-4-3-5-11(8-10)12-13-6-7-15-12/h3-8H,9H2,1-2H3 |
| InChIKey | KJMWSKYVPWXJBB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |