C14H16N2 — CID 91152039
N,N-dimethyl-1-(3-pyridin-2-ylphenyl)methanamine (PubChem CID 91152039) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is N,N-dimethyl-1-(3-pyridin-2-ylphenyl)methanamine.
| Compound Name | N,N-dimethyl-1-(3-pyridin-2-ylphenyl)methanamine |
|---|---|
| PubChem CID | 91152039 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N,N-dimethyl-1-(3-pyridin-2-ylphenyl)methanamine |
| SMILES | CN(C)Cc1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C14H16N2/c1-16(2)11-12-6-5-7-13(10-12)14-8-3-4-9-15-14/h3-10H,11H2,1-2H3 |
| InChIKey | JTTNCERGSWCMIH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |