C14H16N2S — CID 54864565
N-cyclopentyl-3-(1,3-thiazol-2-yl)aniline (PubChem CID 54864565) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is N-cyclopentyl-3-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-cyclopentyl-3-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 54864565 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-cyclopentyl-3-(1,3-thiazol-2-yl)aniline |
| SMILES | c1cc(NC2CCCC2)cc(-c2nccs2)c1 |
| InChI | InChI=1S/C14H16N2S/c1-2-6-12(5-1)16-13-7-3-4-11(10-13)14-15-8-9-17-14/h3-4,7-10,12,16H,1-2,5-6H2 |
| InChIKey | GBTQPOORXCUXMR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |