C15H18ClN3OS — CID 119399855
(2R)-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119399855) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is (2R)-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119399855 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (2R)-N-[3-(1,3-thiazol-2-yl)phenyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(-c2nccs2)c1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C15H17N3OS.ClH/c19-14(13-6-1-2-7-16-13)18-12-5-3-4-11(10-12)15-17-8-9-20-15;/h3-5,8-10,13,16H,1-2,6-7H2,(H,18,19);1H/t13-;/m1./s1 |
| InChIKey | FAIKDWALXPFHDO-BTQNPOSSSA-N |
| XLogP | 3.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |