C15H17N3OS2 — CID 96528063
1-[(3R)-thian-3-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea (PubChem CID 96528063) has the molecular formula C15H17N3OS2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-[(3R)-thian-3-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea.
| Compound Name | 1-[(3R)-thian-3-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 96528063 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-[(3R)-thian-3-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2nccs2)c1)N[C@@H]1CCCSC1 |
| InChI | InChI=1S/C15H17N3OS2/c19-15(18-13-5-2-7-20-10-13)17-12-4-1-3-11(9-12)14-16-6-8-21-14/h1,3-4,6,8-9,13H,2,5,7,10H2,(H2,17,18,19)/t13-/m1/s1 |
| InChIKey | AVGKVPNUFUKNOM-CYBMUJFWSA-N |
| XLogP | 3.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |