C14H16N2O2S2 — CID 60935054
1,1-dioxo-N-[3-(1,3-thiazol-2-yl)phenyl]thian-4-amine (PubChem CID 60935054) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1,1-dioxo-N-[3-(1,3-thiazol-2-yl)phenyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[3-(1,3-thiazol-2-yl)phenyl]thian-4-amine |
|---|---|
| PubChem CID | 60935054 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1,1-dioxo-N-[3-(1,3-thiazol-2-yl)phenyl]thian-4-amine |
| SMILES | O=S1(=O)CCC(Nc2cccc(-c3nccs3)c2)CC1 |
| InChI | InChI=1S/C14H16N2O2S2/c17-20(18)8-4-12(5-9-20)16-13-3-1-2-11(10-13)14-15-6-7-19-14/h1-3,6-7,10,12,16H,4-5,8-9H2 |
| InChIKey | KXGFWYFOPGOKKV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |