C15H18N2S2 — CID 79957399
2-methyl-N-[3-(1,3-thiazol-2-yl)phenyl]thian-3-amine (PubChem CID 79957399) has the molecular formula C15H18N2S2 and a molecular weight of 290.46 g/mol. Its IUPAC name is 2-methyl-N-[3-(1,3-thiazol-2-yl)phenyl]thian-3-amine.
| Compound Name | 2-methyl-N-[3-(1,3-thiazol-2-yl)phenyl]thian-3-amine |
|---|---|
| PubChem CID | 79957399 |
| Molecular Formula | C15H18N2S2 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-methyl-N-[3-(1,3-thiazol-2-yl)phenyl]thian-3-amine |
| SMILES | CC1SCCCC1Nc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C15H18N2S2/c1-11-14(6-3-8-18-11)17-13-5-2-4-12(10-13)15-16-7-9-19-15/h2,4-5,7,9-11,14,17H,3,6,8H2,1H3 |
| InChIKey | DRNBCSDXXDAEFI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |