C16H17N3O2S — CID 111631344
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea (PubChem CID 111631344) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 111631344 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[3-(1,3-thiazol-2-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2nccs2)c1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C16H17N3O2S/c20-10-11-4-5-14(8-11)19-16(21)18-13-3-1-2-12(9-13)15-17-6-7-22-15/h1-7,9,11,14,20H,8,10H2,(H2,18,19,21)/t11-,14+/m0/s1 |
| InChIKey | PASIGXZKZSKRIM-SMDDNHRTSA-N |
| XLogP | 2.87 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|