C11H10N2S — CID 67815509
2-(6-prop-2-enyl-2-pyridinyl)-1,3-thiazole (PubChem CID 67815509) has the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(6-prop-2-enyl-2-pyridinyl)-1,3-thiazole.
| Compound Name | 2-(6-prop-2-enyl-2-pyridinyl)-1,3-thiazole |
|---|---|
| PubChem CID | 67815509 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-(6-prop-2-enyl-2-pyridinyl)-1,3-thiazole |
| SMILES | C=CCc1cccc(-c2nccs2)n1 |
| InChI | InChI=1S/C11H10N2S/c1-2-4-9-5-3-6-10(13-9)11-12-7-8-14-11/h2-3,5-8H,1,4H2 |
| InChIKey | FDIDVIRJABGSBJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|