C12H10N4S2 — CID 175739771
2-[4-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]benzene-1,3-diamine (PubChem CID 175739771) has the molecular formula C12H10N4S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-[4-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]benzene-1,3-diamine.
| Compound Name | 2-[4-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 175739771 |
| Molecular Formula | C12H10N4S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2-[4-(1,3-thiazol-2-yl)-1,3-thiazol-2-yl]benzene-1,3-diamine |
| SMILES | Nc1cccc(N)c1-c1nc(-c2nccs2)cs1 |
| InChI | InChI=1S/C12H10N4S2/c13-7-2-1-3-8(14)10(7)12-16-9(6-18-12)11-15-4-5-17-11/h1-6H,13-14H2 |
| InChIKey | WLNJITZCPMJBDQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|