C13H11N3OS2 — CID 163214674
N-(3-methoxyphenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine (PubChem CID 163214674) has the molecular formula C13H11N3OS2 and a molecular weight of 289.39 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(3-methoxyphenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 163214674 |
| Molecular Formula | C13H11N3OS2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-(3-methoxyphenyl)-4-(1,3-thiazol-2-yl)-1,3-thiazol-2-amine |
| SMILES | COc1cccc(Nc2nc(-c3nccs3)cs2)c1 |
| InChI | InChI=1S/C13H11N3OS2/c1-17-10-4-2-3-9(7-10)15-13-16-11(8-19-13)12-14-5-6-18-12/h2-8H,1H3,(H,15,16) |
| InChIKey | JKWZQCUWPCQGJF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |