C24H21N3O3S — CID 5178891
4-methoxy-N-[4-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 5178891) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 4-methoxy-N-[4-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[4-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 5178891 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-methoxy-N-[4-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3csc(Nc4cccc(OC)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O3S/c1-29-20-12-8-17(9-13-20)23(28)25-18-10-6-16(7-11-18)22-15-31-24(27-22)26-19-4-3-5-21(14-19)30-2/h3-15H,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | RBHKGOVZTATHMZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |