C24H20FN3O3S — CID 42764822
N-[3-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]phenyl]-3,5-dimethoxybenzamide (PubChem CID 42764822) has the molecular formula C24H20FN3O3S and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[3-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]phenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 42764822 |
| Molecular Formula | C24H20FN3O3S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-[3-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]phenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2cccc(-c3csc(Nc4ccc(F)cc4)n3)c2)c1 |
| InChI | InChI=1S/C24H20FN3O3S/c1-30-20-11-16(12-21(13-20)31-2)23(29)26-19-5-3-4-15(10-19)22-14-32-24(28-22)27-18-8-6-17(25)7-9-18/h3-14H,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | BMFRMHSZMSRZAZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |