C23H18ClN3O2S — CID 3694257
N-[4-[2-(3-chloroanilino)-1,3-thiazol-4-yl]phenyl]-3-methoxybenzamide (PubChem CID 3694257) has the molecular formula C23H18ClN3O2S and a molecular weight of 435.94 g/mol. Its IUPAC name is N-[4-[2-(3-chloroanilino)-1,3-thiazol-4-yl]phenyl]-3-methoxybenzamide.
| Compound Name | N-[4-[2-(3-chloroanilino)-1,3-thiazol-4-yl]phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 3694257 |
| Molecular Formula | C23H18ClN3O2S |
| Molecular Weight | 435.94 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N-[4-[2-(3-chloroanilino)-1,3-thiazol-4-yl]phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(-c3csc(Nc4cccc(Cl)c4)n3)cc2)c1 |
| InChI | InChI=1S/C23H18ClN3O2S/c1-29-20-7-2-4-16(12-20)22(28)25-18-10-8-15(9-11-18)21-14-30-23(27-21)26-19-6-3-5-17(24)13-19/h2-14H,1H3,(H,25,28)(H,26,27) |
| InChIKey | HLFYCHFEOHAZQY-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.94 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |