C14H16N2S — CID 151399077
2-[4-(pyrrolidin-1-ylmethyl)phenyl]-1,3-thiazole (PubChem CID 151399077) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-[4-(pyrrolidin-1-ylmethyl)phenyl]-1,3-thiazole.
| Compound Name | 2-[4-(pyrrolidin-1-ylmethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 151399077 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-[4-(pyrrolidin-1-ylmethyl)phenyl]-1,3-thiazole |
| SMILES | c1csc(-c2ccc(CN3CCCC3)cc2)n1 |
| InChI | InChI=1S/C14H16N2S/c1-2-9-16(8-1)11-12-3-5-13(6-4-12)14-15-7-10-17-14/h3-7,10H,1-2,8-9,11H2 |
| InChIKey | OWCAAQNCMHJQSM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |