C8H12N2OS — CID 139682098
2-(pyrrolidin-1-ylmethoxy)-1,3-thiazole (PubChem CID 139682098) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-(pyrrolidin-1-ylmethoxy)-1,3-thiazole.
| Compound Name | 2-(pyrrolidin-1-ylmethoxy)-1,3-thiazole |
|---|---|
| PubChem CID | 139682098 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-(pyrrolidin-1-ylmethoxy)-1,3-thiazole |
| SMILES | c1csc(OCN2CCCC2)n1 |
| InChI | InChI=1S/C8H12N2OS/c1-2-5-10(4-1)7-11-8-9-3-6-12-8/h3,6H,1-2,4-5,7H2 |
| InChIKey | SEKMNOMUXKUDOH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |