C9H13NO2S — CID 126953986
2-(oxan-4-ylmethoxy)-1,3-thiazole (PubChem CID 126953986) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is 2-(oxan-4-ylmethoxy)-1,3-thiazole.
| Compound Name | 2-(oxan-4-ylmethoxy)-1,3-thiazole |
|---|---|
| PubChem CID | 126953986 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-(oxan-4-ylmethoxy)-1,3-thiazole |
| SMILES | c1csc(OCC2CCOCC2)n1 |
| InChI | InChI=1S/C9H13NO2S/c1-4-11-5-2-8(1)7-12-9-10-3-6-13-9/h3,6,8H,1-2,4-5,7H2 |
| InChIKey | BQSLNWZXYSUJLT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |