C10H16N2OS — CID 164631730
2-[[(2R)-1-methylpiperidin-2-yl]methoxy]-1,3-thiazole (PubChem CID 164631730) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-[[(2R)-1-methylpiperidin-2-yl]methoxy]-1,3-thiazole.
| Compound Name | 2-[[(2R)-1-methylpiperidin-2-yl]methoxy]-1,3-thiazole |
|---|---|
| PubChem CID | 164631730 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-[[(2R)-1-methylpiperidin-2-yl]methoxy]-1,3-thiazole |
| SMILES | CN1CCCC[C@@H]1COc1nccs1 |
| InChI | InChI=1S/C10H16N2OS/c1-12-6-3-2-4-9(12)8-13-10-11-5-7-14-10/h5,7,9H,2-4,6,8H2,1H3/t9-/m1/s1 |
| InChIKey | QHJLJOKAKXJFKE-SECBINFHSA-N |
| XLogP | 2.01 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |