C9H14N2S2 — CID 84592058
4-(1,3-thiazol-2-ylmethyl)-1,4-thiazepane (PubChem CID 84592058) has the molecular formula C9H14N2S2 and a molecular weight of 214.36 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-ylmethyl)-1,4-thiazepane.
| Compound Name | 4-(1,3-thiazol-2-ylmethyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 84592058 |
| Molecular Formula | C9H14N2S2 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4-(1,3-thiazol-2-ylmethyl)-1,4-thiazepane |
| SMILES | c1csc(CN2CCCSCC2)n1 |
| InChI | InChI=1S/C9H14N2S2/c1-3-11(4-7-12-5-1)8-9-10-2-6-13-9/h2,6H,1,3-5,7-8H2 |
| InChIKey | MCJZVLVWRCGBAC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |