C12H21N3S — CID 115752802
N-propan-2-yl-1-(1,3-thiazol-2-ylmethyl)piperidin-4-amine (PubChem CID 115752802) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is N-propan-2-yl-1-(1,3-thiazol-2-ylmethyl)piperidin-4-amine.
| Compound Name | N-propan-2-yl-1-(1,3-thiazol-2-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 115752802 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-propan-2-yl-1-(1,3-thiazol-2-ylmethyl)piperidin-4-amine |
| SMILES | CC(C)NC1CCN(Cc2nccs2)CC1 |
| InChI | InChI=1S/C12H21N3S/c1-10(2)14-11-3-6-15(7-4-11)9-12-13-5-8-16-12/h5,8,10-11,14H,3-4,6-7,9H2,1-2H3 |
| InChIKey | CJWOEINOUMWLBT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |