C13H23N3S — CID 65073726
1-propan-2-yl-N-(1,3-thiazol-2-ylmethyl)azepan-4-amine (PubChem CID 65073726) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-propan-2-yl-N-(1,3-thiazol-2-ylmethyl)azepan-4-amine.
| Compound Name | 1-propan-2-yl-N-(1,3-thiazol-2-ylmethyl)azepan-4-amine |
|---|---|
| PubChem CID | 65073726 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-propan-2-yl-N-(1,3-thiazol-2-ylmethyl)azepan-4-amine |
| SMILES | CC(C)N1CCCC(NCc2nccs2)CC1 |
| InChI | InChI=1S/C13H23N3S/c1-11(2)16-7-3-4-12(5-8-16)15-10-13-14-6-9-17-13/h6,9,11-12,15H,3-5,7-8,10H2,1-2H3 |
| InChIKey | ATXOQSHSHWBGOO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |