C11H22N6 — CID 65073250
1-propan-2-yl-N-(2H-tetrazol-5-ylmethyl)azepan-4-amine (PubChem CID 65073250) has the molecular formula C11H22N6 and a molecular weight of 238.34 g/mol. Its IUPAC name is 1-propan-2-yl-N-(2H-tetrazol-5-ylmethyl)azepan-4-amine.
| Compound Name | 1-propan-2-yl-N-(2H-tetrazol-5-ylmethyl)azepan-4-amine |
|---|---|
| PubChem CID | 65073250 |
| Molecular Formula | C11H22N6 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1-propan-2-yl-N-(2H-tetrazol-5-ylmethyl)azepan-4-amine |
| SMILES | CC(C)N1CCCC(NCc2nn[nH]n2)CC1 |
| InChI | InChI=1S/C11H22N6/c1-9(2)17-6-3-4-10(5-7-17)12-8-11-13-15-16-14-11/h9-10,12H,3-8H2,1-2H3,(H,13,14,15,16) |
| InChIKey | DQBQUXSBWUHLLW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |