C10H16N4OS — CID 61283472
4-(1,3-thiazol-2-ylmethylamino)piperidine-1-carboxamide (PubChem CID 61283472) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-ylmethylamino)piperidine-1-carboxamide.
| Compound Name | 4-(1,3-thiazol-2-ylmethylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 61283472 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-(1,3-thiazol-2-ylmethylamino)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(NCc2nccs2)CC1 |
| InChI | InChI=1S/C10H16N4OS/c11-10(15)14-4-1-8(2-5-14)13-7-9-12-3-6-16-9/h3,6,8,13H,1-2,4-5,7H2,(H2,11,15) |
| InChIKey | OTAJBYIRTONYMV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |