About 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine
3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine (PubChem CID 79462024) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine |
| PubChem CID | 79462024 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine |
| SMILES | NC1CCC(NCc2nccs2)C1 |
| InChI | InChI=1S/C9H15N3S/c10-7-1-2-8(5-7)12-6-9-11-3-4-13-9/h3-4,7-8,12H,1-2,5-6,10H2 |
| InChIKey | CFJHMZFYLPLRNW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine?
The IUPAC name of 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine (CID 79462024) is 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine.
What is the SMILES notation for 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine?
The canonical SMILES for 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine is NC1CCC(NCc2nccs2)C1.
What is the InChIKey of 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine?
The InChIKey is CFJHMZFYLPLRNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c10-7-1-2-8(5-7)12-6-9-11-3-4-13-9/h3-4,7-8,12H,1-2,5-6,10H2.
What are the key properties of 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine?
3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine has a molecular weight of 197.31 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine is sourced from PubChem (CID 79462024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).