C9H15N3S — CID 79462024
3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine (PubChem CID 79462024) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine.
| Compound Name | 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 79462024 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-N-(1,3-thiazol-2-ylmethyl)cyclopentane-1,3-diamine |
| SMILES | NC1CCC(NCc2nccs2)C1 |
| InChI | InChI=1S/C9H15N3S/c10-7-1-2-8(5-7)12-6-9-11-3-4-13-9/h3-4,7-8,12H,1-2,5-6,10H2 |
| InChIKey | CFJHMZFYLPLRNW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |