About 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride
1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride (PubChem CID 54593962) has the molecular formula C8H13ClN2S
and a molecular weight of 204.73 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride.
Analyze 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride?
The IUPAC name of 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride (CID 54593962) is 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride.
What is the SMILES notation for 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride?
The canonical SMILES for 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride is Cl.NC1(c2nccs2)CCCC1.
What is the InChIKey of 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride?
The InChIKey is GGWLIKPKZNOUCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S.ClH/c9-8(3-1-2-4-8)7-10-5-6-11-7;/h5-6H,1-4,9H2;1H.
What are the key properties of 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride?
1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride has a molecular weight of 204.73 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazol-2-yl)cyclopentan-1-amine;hydrochloride is sourced from PubChem (CID 54593962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).